CymitQuimica logo

CAS 1049-84-9

:

2-{carboxy[(phenoxyacetyl)amino]methyl}-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid

Description:
2-{Carboxy[(phenoxyacetyl)amino]methyl}-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid, commonly referred to by its CAS number 1049-84-9, is a thiazolidine derivative characterized by its complex structure that includes both carboxylic acid and amine functional groups. This compound features a thiazolidine ring, which contributes to its potential biological activity, particularly in medicinal chemistry. The presence of the phenoxyacetyl group suggests possible interactions with biological targets, making it of interest in pharmaceutical research. Its carboxylic acid groups can participate in hydrogen bonding and ionic interactions, enhancing its solubility and reactivity in various environments. The dimethyl substitution on the thiazolidine ring may influence its steric properties and overall stability. This compound is typically studied for its potential applications in drug development, particularly in the context of metabolic diseases or as a scaffold for synthesizing other bioactive molecules. As with many thiazolidine derivatives, it may exhibit unique pharmacological properties that warrant further investigation.
Formula:C16H20N2O6S
InChI:InChI=1/C16H20N2O6S/c1-16(2)12(15(22)23)18-13(25-16)11(14(20)21)17-10(19)8-24-9-6-4-3-5-7-9/h3-7,11-13,18H,8H2,1-2H3,(H,17,19)(H,20,21)(H,22,23)
InChI key:FJTUHYOOCYRLJI-UHFFFAOYSA-N
SMILES:CC1(C)C(C(=O)O)NC(C(C(=O)O)N=C(COc2ccccc2)O)S1
Found 7 products.