CAS 1049030-32-1

Ethyl 4-(2-methoxyethoxy)-γ-oxobenzenebutanoate

Description:

Ethyl 4-(2-methoxyethoxy)-γ-oxobenzenebutanoate, identified by its CAS number 1049030-32-1, is an organic compound characterized by its ester functional group and a complex aromatic structure. This substance features a butanoate moiety, which contributes to its ester characteristics, while the presence of a methoxyethoxy group enhances its solubility in organic solvents. The compound is likely to exhibit moderate polarity due to the combination of hydrophobic aromatic and hydrophilic ether functionalities. Ethyl 4-(2-methoxyethoxy)-γ-oxobenzenebutanoate may participate in various chemical reactions typical of esters, such as hydrolysis and transesterification. Its potential applications could span across fields like pharmaceuticals, agrochemicals, or materials science, depending on its reactivity and biological properties. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks associated with exposure. Further studies would be necessary to fully elucidate its properties, reactivity, and potential applications.

Formula: C₁₅H₂₀O₅

InChI: InChI=1S/C15H20O5/c1-3-19-15(17)9-8-14(16)12-4-6-13(7-5-12)20-11-10-18-2/h4-7H,3,8-11H2,1-2H3

InChI key: InChIKey=YKPCAQUVTOLZBB-UHFFFAOYSA-N

SMILES: C(CCC(OCC)=O)(=O)C1=CC=C(OCCOC)C=C1

Synonyms:

• Ethyl 4-(2-methoxyethoxy)-γ-oxobenzenebutanoate
• Benzenebutanoic acid, 4-(2-methoxyethoxy)-γ-oxo-, ethyl ester

ethyl 4-[4-(2-Methoxyethoxy)phenyl]-4-oxobutyrate

CAS: 1049030-32-1

Formula: C₁₅H₂₀O₅

Purity: 97.0%

Molecular weight: 280.32

Ref: 10-F208215