CAS 104926-86-5: 1,2-Dihydro-4-hydroxy-1-oxo-3-isoquinolinecarboxylic acid hydrazide
Description:1,2-Dihydro-4-hydroxy-1-oxo-3-isoquinolinecarboxylic acid hydrazide, with the CAS number 104926-86-5, is a chemical compound that belongs to the class of isoquinoline derivatives. This substance typically exhibits a complex structure characterized by the presence of a hydrazide functional group, which is known for its reactivity and potential biological activity. The compound may display various properties such as solubility in organic solvents, depending on its specific functional groups and molecular interactions. It is often studied for its potential pharmacological applications, including antimicrobial and anti-inflammatory activities. The presence of the hydroxy and carboxylic acid groups suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with biological targets. Additionally, the isoquinoline moiety may contribute to its ability to interact with various enzymes or receptors, making it a subject of interest in medicinal chemistry research. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.
Formula:C10H9N3O3
InChI:InChI=1S/C10H9N3O3/c11-13-10(16)7-8(14)5-3-1-2-4-6(5)9(15)12-7/h1-4,14H,11H2,(H,12,15)(H,13,16)
InChI key:InChIKey=CGUFEFMECHJRBI-UHFFFAOYSA-N
SMILES:O=C1NC(C(=O)NN)=C(O)C=2C=CC=CC12
- Synonyms:
- 1,4-Dihydroxyisoquinoline-3-carbohydrazide
- 3-Isoquinolinecarboxylic acid, 1,2-dihydro-4-hydroxy-1-oxo-, hydrazide
- 1,2-Dihydro-4-hydroxy-1-oxo-3-isoquinolinecarboxylic acid hydrazide
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 4-hydroxy-1-oxo-1,2-dihydroisoquinoline-3-carbohydrazide REF: 10-F373325CAS: 104926-86-5 | - - - | - - - | Discontinued product |
 | 4-Hydroxy-1-oxo-1,2-dihydroisoquinoline-3-carbohydrazide REF: 3D-FH131015CAS: 104926-86-5 | Min. 95% | - - - | Discontinued product |
4-hydroxy-1-oxo-1,2-dihydroisoquinoline-3-carbohydrazide
Ref: 10-F373325
| 1g | Discontinued | Request information | |
| 250mg | Discontinued | Request information |
4-Hydroxy-1-oxo-1,2-dihydroisoquinoline-3-carbohydrazide
Ref: 3D-FH131015
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
