CAS 10493-38-6

2-Methoxybenzenebutanol

Description:

2-Methoxybenzenebutanol, also known as 4-(2-methoxyphenyl)butan-2-ol, is an organic compound characterized by its aromatic structure and the presence of both a methoxy group and a butanol moiety. This compound features a methoxy group (-OCH3) attached to a benzene ring, which contributes to its solubility and reactivity. The butanol portion introduces a hydroxyl group (-OH), making it an alcohol, which enhances its potential for hydrogen bonding and solubility in polar solvents. 2-Methoxybenzenebutanol is typically a colorless to pale yellow liquid with a moderate boiling point and a relatively low vapor pressure. It is expected to exhibit moderate toxicity and should be handled with care in laboratory settings. The compound may find applications in organic synthesis, as a solvent, or as an intermediate in the production of other chemical substances. Its specific physical and chemical properties, such as melting point, boiling point, and density, can vary based on purity and environmental conditions.

Formula: C₁₁H₁₆O₂

InChI: InChI=1S/C11H16O2/c1-13-11-8-3-2-6-10(11)7-4-5-9-12/h2-3,6,8,12H,4-5,7,9H2,1H3

InChI key: InChIKey=LICCCCCCEBHYTF-UHFFFAOYSA-N

SMILES: C(CCCO)C1=C(OC)C=CC=C1

Synonyms:

• 1-Butanol, 4-(o-methoxyphenyl)-
• 2-Methoxybenzenebutanol
• Benzenebutanol, 2-methoxy-