CAS 104947-69-5
:bengamide B
Description:
Bengamide B is a naturally occurring compound classified as a secondary metabolite, primarily derived from certain marine organisms, particularly sponges. It belongs to the class of compounds known as alkaloids, which are characterized by their nitrogen-containing structures and diverse biological activities. Bengamide B exhibits notable pharmacological properties, including potential anti-cancer and anti-inflammatory effects, making it a subject of interest in medicinal chemistry and drug development. The compound's structure features a complex arrangement of carbon, hydrogen, and nitrogen atoms, contributing to its unique reactivity and interaction with biological targets. Additionally, bengamide B has been studied for its potential role in inhibiting specific enzymes and pathways associated with disease processes. Its low solubility in water and moderate lipophilicity suggest that it may interact effectively with lipid membranes, influencing its bioavailability and therapeutic efficacy. Overall, bengamide B represents a promising candidate for further research in the field of natural product chemistry and pharmacology.
Formula:C32H58N2O8
InChI:InChI=1/C32H58N2O8/c1-6-7-8-9-10-11-12-13-14-15-16-17-27(36)42-24-19-20-25(32(40)34(4)22-24)33-31(39)30(41-5)29(38)28(37)26(35)21-18-23(2)3/h18,21,23-26,28-30,35,37-38H,6-17,19-20,22H2,1-5H3,(H,33,39)/b21-18+/t24-,25-,26+,28-,29+,30+/m0/s1
Synonyms:- (3S,6S)-1-methyl-7-oxo-6-{[(2R,3R,4S,5R,6E)-3,4,5-trihydroxy-2-methoxy-8-methylnon-6-enoyl]amino}azepan-3-yl tetradecanoate (non-preferred name)
- Bengamide B
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Bengamide B
CAS:<p>Potent NF-κB inhibitor, IC50 at 85 nM. Reduces IκBα phosphorylation, NO, TNF-α, IL-6, MCP. Inhibits HeLa, HCT116 cell growth. Anti-inflammatory, antitumor.</p>Formula:C32H58N2O8Color and Shape:SolidMolecular weight:598.81
