CAS 10496-16-9
:Diheptyl disulfide
Description:
Diheptyl disulfide is an organic compound characterized by its structure, which features two heptyl groups (seven-carbon alkyl chains) connected by a disulfide bond (–S–S–). This compound is typically a colorless to pale yellow liquid with a distinctive odor, often associated with sulfur-containing compounds. It is insoluble in water but soluble in organic solvents, which is common for many sulfur-containing organic compounds. Diheptyl disulfide is known for its applications in the fragrance industry, as well as in the synthesis of other chemical compounds. Its properties include a relatively high boiling point and moderate volatility, making it important in various chemical processes. Additionally, like other disulfides, it may exhibit some degree of toxicity and should be handled with care in laboratory settings. Overall, diheptyl disulfide is a notable compound within the class of organosulfur compounds, contributing to both industrial applications and research in organic chemistry.
Formula:C14H30S2
InChI:InChI=1S/C14H30S2/c1-3-5-7-9-11-13-15-16-14-12-10-8-6-4-2/h3-14H2,1-2H3
InChI key:InChIKey=IFGAFLQUAVLERP-UHFFFAOYSA-N
SMILES:S(SCCCCCCC)CCCCCCC
Synonyms:- 1-(Heptyldisulfanyl)Heptane
- Di-n-heptyl disulfide
- Diheptyl disulfide
- Disulfide, diheptyl
- Heptyl disulfide
- NSC 97275
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
