CAS 10496-51-2

2-(2-Furanylmethylene)cyclohexanone

Description:

2-(2-Furanylmethylene)cyclohexanone, with the CAS number 10496-51-2, is an organic compound characterized by its unique structure that combines a cyclohexanone moiety with a furan ring. This compound typically exhibits a yellow to brown color and is known for its aromatic properties, which can contribute to its potential applications in flavoring and fragrance industries. The presence of the furan ring imparts reactivity, particularly in electrophilic addition reactions, making it a valuable intermediate in organic synthesis. Additionally, the compound may exhibit biological activity, which has been explored in various studies, suggesting potential pharmacological applications. Its solubility is generally influenced by the functional groups present, and it may be soluble in organic solvents while having limited solubility in water. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 2-(2-Furanylmethylene)cyclohexanone represents a versatile compound with interesting chemical properties and potential applications in various fields.

Formula: C₁₁H₁₂O₂

InChI: InChI=1S/C11H12O2/c12-11-6-2-1-4-9(11)8-10-5-3-7-13-10/h3,5,7-8H,1-2,4,6H2

InChI key: InChIKey=XLILSZDCLCSYMR-UHFFFAOYSA-N

SMILES: C(=C1C(=O)CCCC1)C2=CC=CO2

Synonyms:

• NSC 201622
• Cyclohexanone, 2-(2-furanylmethylene)-
• 2-Furfurylidenecyclohexanone
• 2-(2-Furanylmethylene)cyclohexanone
• Cyclohexanone, 2-furfurylidene-