CAS 104960-50-1

2-Mercapto-6-thien-2-yl-4-(trifluoromethyl)pyridine-3-carbonitrile

Description:

2-Mercapto-6-thien-2-yl-4-(trifluoromethyl)pyridine-3-carbonitrile, with the CAS number 104960-50-1, is a chemical compound characterized by its unique structural features, including a pyridine ring, a thiophene moiety, and a trifluoromethyl group. The presence of the mercapto (-SH) functional group indicates that it can participate in various chemical reactions, including nucleophilic substitutions and redox reactions. The trifluoromethyl group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. Additionally, the carbonitrile (-C≡N) group contributes to the compound's polarity and can serve as a site for further chemical modifications. This compound may exhibit interesting pharmacological properties, potentially acting as a ligand or inhibitor in biological systems. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would depend on the specific conditions under which it is handled. Overall, this compound represents a valuable structure for research in both synthetic and medicinal chemistry.

Formula: C₁₅H₉F₃N₂O₂S

InChI: InChI=1/C15H9F3N2O2S/c16-15(17,18)8-6-9(7-4-2-1-3-5-7)20-13-10(8)11(19)12(23-13)14(21)22/h1-6H,19H2,(H,21,22)

SMILES: c1ccc(cc1)c1cc(c2c(c(C(=O)O)sc2n1)N)C(F)(F)F

Synonyms:

• 6-(Thien-2-yl)-2-thiol-4-(trifluoromethyl)pyridine
• 6-(Thiophen-2-Yl)-2-Thioxo-4-(Trifluoromethyl)-1,2-Dihydropyridine-3-Carbonitrile
• 3-Amino-6-Phenyl-4-(Trifluoromethyl)Thieno[2,3-B]Pyridine-2-Carboxylic Acid