CymitQuimica logo

CAS 1049604-83-2

:

2-Chloro-N-[2-(diethylamino)-5-[(diethylamino)sulfonyl]phenyl]acetamide

Description:
2-Chloro-N-[2-(diethylamino)-5-[(diethylamino)sulfonyl]phenyl]acetamide, identified by its CAS number 1049604-83-2, is a synthetic organic compound characterized by its complex structure, which includes a chloro group, a diethylamino moiety, and a sulfonyl group. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential biological activity due to its amine and sulfonamide functionalities. The presence of the chloro substituent may influence its reactivity and interaction with biological targets. As a sulfonamide derivative, it may also exhibit pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in drug development, particularly in areas targeting specific biological pathways. However, detailed studies on its toxicity, stability, and specific applications would be necessary to fully understand its characteristics and potential uses in various fields, including pharmaceuticals and agrochemicals.
Formula:C16H26ClN3O3S
InChI:InChI=1S/C16H26ClN3O3S/c1-5-19(6-2)15-10-9-13(11-14(15)18-16(21)12-17)24(22,23)20(7-3)8-4/h9-11H,5-8,12H2,1-4H3,(H,18,21)
InChI key:InChIKey=OLYDVOSRTOHPBH-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)C1=C(N(CC)CC)C=CC(S(N(CC)CC)(=O)=O)=C1
Synonyms:
  • Acetamide, 2-chloro-N-[2-(diethylamino)-5-[(diethylamino)sulfonyl]phenyl]-
  • 2-Chloro-N-[2-(diethylamino)-5-[(diethylamino)sulfonyl]phenyl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.