CAS 1049604-97-8
:3-[(2-Chloroacetyl)amino]-N,N-dimethylbenzamide
Description:
3-[(2-Chloroacetyl)amino]-N,N-dimethylbenzamide is a chemical compound characterized by its amide functional group, which is derived from benzoic acid. The presence of a chloroacetyl group introduces both electrophilic and steric properties, influencing its reactivity and potential biological activity. This compound typically exhibits moderate to high solubility in polar organic solvents due to the presence of the amide bond, while its aromatic ring contributes to hydrophobic characteristics. The chloroacetyl moiety can participate in nucleophilic substitution reactions, making it a potential intermediate in organic synthesis. Additionally, the dimethyl substitution on the nitrogen atom enhances the steric bulk, which may affect the compound's interaction with biological targets, potentially leading to pharmacological applications. Overall, the unique structural features of 3-[(2-Chloroacetyl)amino]-N,N-dimethylbenzamide suggest it may possess interesting chemical reactivity and biological properties, warranting further investigation in medicinal chemistry and related fields.
Formula:C11H13ClN2O2
InChI:InChI=1S/C11H13ClN2O2/c1-14(2)11(16)8-4-3-5-9(6-8)13-10(15)7-12/h3-6H,7H2,1-2H3,(H,13,15)
InChI key:InChIKey=CAPONPDCOFTECB-UHFFFAOYSA-N
SMILES:C(N(C)C)(=O)C1=CC(NC(CCl)=O)=CC=C1
Synonyms:- Benzamide, 3-[(2-chloroacetyl)amino]-N,N-dimethyl-
- 3-[(2-Chloroacetyl)amino]-N,N-dimethylbenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.