CAS 1049605-05-1

7-(1-Methylethyl)[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylic acid

Description:

7-(1-Methylethyl)[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylic acid is a heterocyclic compound characterized by its unique triazole and pyrimidine ring structures. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity in various chemical reactions. The presence of the isopropyl group (1-methylethyl) enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. The triazole moiety is known for its role in medicinal chemistry, often exhibiting antimicrobial and antifungal properties. Additionally, the compound's structural complexity may allow for diverse interactions with biological targets, making it of interest in drug development. Its specific properties, such as melting point, solubility, and spectral characteristics, would typically be determined through experimental methods. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior, highlighting its potential applications in pharmaceuticals and agrochemicals.

Formula: C₉H₁₀N₄O₂

InChI: InChI=1S/C9H10N4O2/c1-5(2)7-6(8(14)15)3-10-9-11-4-12-13(7)9/h3-5H,1-2H3,(H,14,15)

InChI key: InChIKey=OWNYPQNGRGYQPI-UHFFFAOYSA-N

SMILES: C(C)(C)C=1N2C(N=CC1C(O)=O)=NC=N2

Synonyms:

• [1,2,4]Triazolo[1,5-a]pyrimidine-6-carboxylic acid, 7-(1-methylethyl)-
• 7-(1-Methylethyl)[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylic acid

7-(Propan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylic acid

CAS: 1049605-05-1

Versatile small molecule scaffold

Formula: C₉H₁₀N₄O₂

Purity: Min. 95%

Molecular weight: 206.2 g/mol

Ref: 3D-ZRB60505