
CAS 1049605-44-8
:N-[3-(Aminomethyl)-2-pyridinyl]sulfamide
Description:
N-[3-(Aminomethyl)-2-pyridinyl]sulfamide is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with an aminomethyl group and a sulfamide functional group. This compound typically exhibits properties associated with both amines and sulfonamides, such as potential solubility in polar solvents and the ability to form hydrogen bonds due to the presence of the amino and sulfamide groups. It may also demonstrate biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. The presence of the pyridine moiety suggests potential interactions with biological receptors or enzymes. Additionally, the compound's stability, reactivity, and potential toxicity would depend on its specific molecular interactions and the conditions under which it is used. As with many chemical substances, safety data and handling precautions are essential for laboratory work involving this compound.
Formula:C6H10N4O2S
InChI:InChI=1S/C6H10N4O2S/c7-4-5-2-1-3-9-6(5)10-13(8,11)12/h1-3H,4,7H2,(H,9,10)(H2,8,11,12)
InChI key:InChIKey=QZSBTGZRTITYIE-UHFFFAOYSA-N
SMILES:N(S(N)(=O)=O)C1=C(CN)C=CC=N1
Synonyms:- N-[3-(Aminomethyl)-2-pyridinyl]sulfamide
- Sulfamide, N-[3-(aminomethyl)-2-pyridinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.