CymitQuimica logo

CAS 1049606-68-9

:

4-Amino-N-methyl-2-quinazolinemethanamine

Description:
4-Amino-N-methyl-2-quinazolinemethanamine is a chemical compound characterized by its quinazoline core structure, which is a bicyclic compound containing both benzene and pyrimidine rings. This compound features an amino group and a methyl group attached to the nitrogen atom, contributing to its basicity and potential reactivity. The presence of the amino group suggests that it may participate in hydrogen bonding and could act as a nucleophile in various chemical reactions. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as quinazoline derivatives are often explored for their biological activities, including anti-cancer and anti-inflammatory properties. The compound's CAS number, 1049606-68-9, allows for precise identification and retrieval of information in chemical databases. Overall, 4-Amino-N-methyl-2-quinazolinemethanamine exhibits characteristics typical of nitrogen-containing heterocycles, making it a subject of interest in both synthetic and medicinal chemistry.
Formula:C10H12N4
InChI:InChI=1S/C10H12N4/c1-12-6-9-13-8-5-3-2-4-7(8)10(11)14-9/h2-5,12H,6H2,1H3,(H2,11,13,14)
InChI key:InChIKey=XPBUWURAZBHZDZ-UHFFFAOYSA-N
SMILES:NC=1C2=C(N=C(CNC)N1)C=CC=C2
Synonyms:
  • 4-Amino-N-methyl-2-quinazolinemethanamine
  • 2-Quinazolinemethanamine, 4-amino-N-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.