CymitQuimica logo

CAS 1049607-22-8

:

7,8-Diethoxy-2,3,4,5-tetrahydro-1H-3-benzazepine

Description:
7,8-Diethoxy-2,3,4,5-tetrahydro-1H-3-benzazepine is a chemical compound characterized by its unique bicyclic structure, which includes a benzene ring fused to a seven-membered nitrogen-containing ring. This compound features two ethoxy groups at the 7 and 8 positions, contributing to its solubility and reactivity. The presence of the tetrahydro configuration indicates that the compound has four hydrogen atoms that saturate the ring, making it less reactive than its unsaturated counterparts. The nitrogen atom in the ring can participate in hydrogen bonding, influencing its interaction with biological systems and potential pharmacological activity. This compound may exhibit interesting properties due to its structural features, making it a candidate for research in medicinal chemistry, particularly in the development of new therapeutic agents. Its CAS number, 1049607-22-8, allows for easy identification and reference in chemical databases. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is studied.
Formula:C14H21NO2
InChI:InChI=1S/C14H21NO2/c1-3-16-13-9-11-5-7-15-8-6-12(11)10-14(13)17-4-2/h9-10,15H,3-8H2,1-2H3
InChI key:InChIKey=KIWFZPCCQMINKJ-UHFFFAOYSA-N
SMILES:O(CC)C=1C=C2C(=CC1OCC)CCNCC2
Synonyms:
  • 1H-3-Benzazepine, 7,8-diethoxy-2,3,4,5-tetrahydro-
  • 7,8-Diethoxy-2,3,4,5-tetrahydro-1H-3-benzazepine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.