CAS 104961-64-0
:N-pyridin-2-yl-beta-alanine
Description:
N-pyridin-2-yl-beta-alanine, with the CAS number 104961-64-0, is an amino acid derivative characterized by the presence of a pyridine ring attached to the beta position of the alanine structure. This compound features both an amino group and a carboxylic acid group, typical of amino acids, which allows it to participate in various biochemical reactions. The pyridine moiety contributes to its unique properties, including potential interactions with biological targets, making it of interest in medicinal chemistry and drug design. N-pyridin-2-yl-beta-alanine may exhibit polar characteristics due to the functional groups present, influencing its solubility in water and organic solvents. Additionally, the compound's structure suggests potential for hydrogen bonding, which can affect its reactivity and interaction with other molecules. Its specific applications may include roles in the synthesis of pharmaceuticals or as a biochemical probe, although detailed studies would be necessary to fully elucidate its biological activity and potential uses.
Formula:C8H10N2O2
InChI:InChI=1/C8H10N2O2/c11-8(12)4-6-10-7-3-1-2-5-9-7/h1-3,5H,4,6H2,(H,9,10)(H,11,12)
SMILES:c1ccnc(c1)NCCC(=O)O
Synonyms:- beta-alanine, N-2-pyridinyl-
- 3-(Pyridin-2-Ylamino)Propanoic Acid
- 3-(2-Pyridinylamino)Propionic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
N-2-Pyridinyl-β-alanine
CAS:Controlled Product<p>Applications Used in the preparation of Dabigatran etexilate derivatives. Acid form of E925620.<br></p>Formula:C8H10N2O2Color and Shape:NeatMolecular weight:166.18



