CymitQuimica logo

CAS 1049672-76-5

:

N-1H-Pyrazolo[3,4-c]pyridin-5-ylacetamide

Description:
N-1H-Pyrazolo[3,4-c]pyridin-5-ylacetamide is a chemical compound characterized by its unique pyrazolo-pyridine structure, which combines features of both pyrazole and pyridine rings. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure includes an acetamide functional group, which can influence its solubility and reactivity. The presence of nitrogen atoms in the heterocyclic rings contributes to its potential as a ligand in various biochemical interactions. Additionally, compounds like N-1H-Pyrazolo[3,4-c]pyridin-5-ylacetamide may exhibit properties such as moderate to high polarity, which can affect their pharmacokinetics and bioavailability. The specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods and can vary based on purity and environmental conditions. Overall, this compound represents a class of heterocyclic compounds that are valuable in the exploration of new therapeutic agents.
Formula:C8H8N4O
InChI:InChI=1S/C8H8N4O/c1-5(13)11-8-2-6-3-10-12-7(6)4-9-8/h2-4H,1H3,(H,10,12)(H,9,11,13)
InChI key:InChIKey=OBYAEDNLDGSZKD-UHFFFAOYSA-N
SMILES:N(C(C)=O)C=1C=C2C(=CN1)NN=C2
Synonyms:
  • N-1H-Pyrazolo[3,4-c]pyridin-5-ylacetamide
  • Acetamide, N-1H-pyrazolo[3,4-c]pyridin-5-yl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.