CAS 1049677-42-0

2-(1,1-Dimethylethyl) octahydro-2H-pyrido[1,2-a]pyrazine-2,7-dicarboxylate

Description:

2-(1,1-Dimethylethyl) octahydro-2H-pyrido[1,2-a]pyrazine-2,7-dicarboxylate is a chemical compound characterized by its complex bicyclic structure, which includes a pyridine and pyrazine moiety. This compound features a tert-butyl group (1,1-dimethylethyl) that contributes to its steric bulk and may influence its reactivity and solubility. The presence of two carboxylate ester groups indicates potential for reactivity, particularly in hydrolysis or transesterification reactions. The octahydro configuration suggests that the compound is fully saturated, which typically enhances stability and reduces reactivity compared to unsaturated analogs. This compound may exhibit interesting biological activities due to its unique structure, making it a candidate for further pharmacological studies. Its solubility and stability in various solvents can vary, depending on the functional groups present. Overall, the characteristics of this compound suggest potential applications in medicinal chemistry and materials science, although specific properties such as melting point, boiling point, and spectral data would require empirical determination.

Formula: C₁₄H₂₄N₂O₄

InChI: InChI=1S/C14H24N2O4/c1-14(2,3)20-13(19)16-7-6-15-8-10(12(17)18)4-5-11(15)9-16/h10-11H,4-9H2,1-3H3,(H,17,18)

InChI key: InChIKey=NVEMTTUHZVHPAP-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC2N(CC(C(O)=O)CC2)CC1

Synonyms:

• 2H-Pyrido[1,2-a]pyrazine-2,7-dicarboxylic acid, octahydro-, 2-(1,1-dimethylethyl) ester
• 2-(1,1-Dimethylethyl) octahydro-2H-pyrido[1,2-a]pyrazine-2,7-dicarboxylate