CAS 1049677-56-6
:3-Bromo-2-(bromomethyl)-1,1-dimethoxypropane
Description:
3-Bromo-2-(bromomethyl)-1,1-dimethoxypropane is an organic compound characterized by its brominated structure and the presence of methoxy groups. It features a propane backbone with two bromine substituents and two methoxy groups, which contribute to its reactivity and solubility properties. The presence of bromine atoms typically enhances the compound's electrophilic character, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The methoxy groups can influence the compound's polarity and solubility in organic solvents. This compound may be utilized in the synthesis of more complex molecules or as an intermediate in chemical reactions. Its specific reactivity and applications would depend on the conditions under which it is used, including temperature, solvent, and the presence of other reagents. As with many brominated compounds, safety precautions should be taken due to potential toxicity and environmental concerns associated with halogenated organic compounds.
Formula:C6H12Br2O2
InChI:InChI=1S/C6H12Br2O2/c1-9-6(10-2)5(3-7)4-8/h5-6H,3-4H2,1-2H3
InChI key:InChIKey=ZLNWUQYSDLPLDM-UHFFFAOYSA-N
SMILES:C(C(OC)OC)(CBr)CBr
Synonyms:- 3-Bromo-2-(bromomethyl)-1,1-dimethoxypropane
- Propane, 3-bromo-2-(bromomethyl)-1,1-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
