CymitQuimica logo

CAS 1049677-62-4

:

1H-Pyrazolo[3,4-d]pyrimidine-4,6(3aH,5H)-dione

Description:
1H-Pyrazolo[3,4-d]pyrimidine-4,6(3aH,5H)-dione, identified by its CAS number 1049677-62-4, is a heterocyclic compound featuring a fused pyrazole and pyrimidine ring system. This compound is characterized by its unique bicyclic structure, which contributes to its potential biological activity. It typically exhibits a range of chemical properties, including solubility in polar solvents and stability under standard laboratory conditions. The presence of the dione functional groups suggests it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Additionally, compounds of this class are often investigated for their pharmacological properties, including anti-inflammatory and anticancer activities. The molecular framework allows for potential interactions with biological targets, making it a subject of interest in medicinal chemistry. Overall, 1H-Pyrazolo[3,4-d]pyrimidine-4,6(3aH,5H)-dione represents a versatile scaffold for further chemical modifications and applications in drug discovery.
Formula:C5H4N4O2
InChI:InChI=1S/C5H4N4O2/c10-4-2-1-6-9-3(2)7-5(11)8-4/h1-2H,(H2,7,8,9,10,11)
InChI key:InChIKey=BMSAROUZJGYAGD-UHFFFAOYSA-N
SMILES:O=C1C2C(=NC(=O)N1)NN=C2
Synonyms:
  • 1H-Pyrazolo[3,4-d]pyrimidine-4,6(3aH,5H)-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.