CAS 1049677-63-5

5,7-Dichloro-1H-indole-3-carboxylic acid

Description:

5,7-Dichloro-1H-indole-3-carboxylic acid is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of two chlorine atoms at the 5 and 7 positions of the indole ring contributes to its unique reactivity and potential biological activity. The carboxylic acid functional group at the 3 position enhances its solubility in polar solvents and allows for potential interactions in biochemical pathways. This compound may exhibit properties such as antimicrobial or anti-inflammatory activity, making it of interest in pharmaceutical research. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of halogens often influences the compound's stability and reactivity, which can be critical in drug design and development. As with many indole derivatives, 5,7-Dichloro-1H-indole-3-carboxylic acid may also serve as a building block for synthesizing more complex molecules in organic chemistry.

Formula: C₉H₅Cl₂NO₂

InChI: InChI=1S/C9H5Cl2NO2/c10-4-1-5-6(9(13)14)3-12-8(5)7(11)2-4/h1-3,12H,(H,13,14)

InChI key: InChIKey=KNHSHFDVTUDMFM-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(NC1)=C(Cl)C=C(Cl)C2

Synonyms:

• 5,7-Dichloro-1H-indole-3-carboxylic acid
• 1H-Indole-3-carboxylic acid, 5,7-dichloro-