CAS 1049677-98-6

Benzenemethanamine, 4-ethoxy-N-propyl-, hydrochloride (1:1)

Description:

Benzenemethanamine, 4-ethoxy-N-propyl-, hydrochloride (1:1), also known by its CAS number 1049677-98-6, is a chemical compound characterized by its amine functional group and aromatic benzene ring. This substance features a propyl group and an ethoxy substituent on the benzene ring, which influences its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. The presence of the ethoxy group enhances its lipophilicity, potentially affecting its biological activity and interaction with various receptors. This compound may be of interest in pharmaceutical research due to its structural features, which could impart specific pharmacological properties. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be utilized in various applications, including medicinal chemistry and material science. Safety data and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₁₂H₁₉NO·ClH

InChI: InChI=1S/C12H19NO.ClH/c1-3-9-13-10-11-5-7-12(8-6-11)14-4-2;/h5-8,13H,3-4,9-10H2,1-2H3;1H

InChI key: InChIKey=IZVIYVPHXRMADH-UHFFFAOYSA-N

SMILES: C(NCCC)C1=CC=C(OCC)C=C1.Cl

Synonyms:

• Benzenemethanamine, 4-ethoxy-N-propyl-, hydrochloride (1:1)