CAS 1049678-17-2

2-Thiophenemethanamine, 5-methyl-N-(1-methylpropyl)-, hydrochloride (1:1)

Description:

2-Thiophenemethanamine, 5-methyl-N-(1-methylpropyl)-, hydrochloride (1:1) is a chemical compound characterized by its thiophene ring structure, which contributes to its aromatic properties and potential biological activity. The presence of the amine functional group indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound's structure suggests potential interactions with biological targets, which may be of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and spectral data, would be essential for further understanding its behavior in different environments. Additionally, safety data and handling precautions are crucial, as with any chemical substance, to ensure safe usage in laboratory and industrial settings. Overall, this compound's unique structural features may offer insights into its potential applications in drug development or other chemical processes.

Formula: C₁₀H₁₇NS·ClH

InChI: InChI=1S/C10H17NS.ClH/c1-4-8(2)11-7-10-6-5-9(3)12-10;/h5-6,8,11H,4,7H2,1-3H3;1H

InChI key: InChIKey=YELGRVRRDRLLAC-UHFFFAOYSA-N

SMILES: C(NC(CC)C)C1=CC=C(C)S1.Cl

Synonyms:

• 2-Thiophenemethanamine, 5-methyl-N-(1-methylpropyl)-, hydrochloride (1:1)