CAS 1049678-18-3

Benzenemethanamine, 3-bromo-N-(1-methylpropyl)-, hydrochloride (1:1)

Description:

Benzenemethanamine, 3-bromo-N-(1-methylpropyl)-, hydrochloride (1:1), with CAS number 1049678-18-3, is a chemical compound characterized by its amine functional group and a bromine substituent on the benzene ring. This compound features a propyl side chain, specifically a 1-methylpropyl group, which contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and research. The presence of the bromine atom may impart specific reactivity, making it a potential candidate for further chemical transformations. The compound's structure suggests it may exhibit biological activity, which could be of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all amines and halogenated compounds, due to potential toxicity and reactivity. Overall, this compound represents a specific class of organic molecules that can be explored for various chemical and biological applications.

Formula: C₁₁H₁₆BrN·ClH

InChI: InChI=1S/C11H16BrN.ClH/c1-3-9(2)13-8-10-5-4-6-11(12)7-10;/h4-7,9,13H,3,8H2,1-2H3;1H

InChI key: InChIKey=LJICSCOZMFDNLV-UHFFFAOYSA-N

SMILES: C(NC(CC)C)C1=CC(Br)=CC=C1.Cl

Synonyms:

• Benzenemethanamine, 3-bromo-N-(1-methylpropyl)-, hydrochloride (1:1)