CAS 1049678-32-1

Benzenemethanamine, 2-(phenylmethoxy)-N-2-propen-1-yl-, hydrochloride (1:1)

Description:

Benzenemethanamine, 2-(phenylmethoxy)-N-2-propen-1-yl-, hydrochloride (1:1), with the CAS number 1049678-32-1, is a chemical compound characterized by its amine functional group and a phenylmethoxy substituent. This compound typically exhibits properties associated with both aromatic and aliphatic structures, contributing to its potential reactivity and solubility in various solvents. The presence of the hydrochloride indicates that it is a salt form, which often enhances its stability and solubility in aqueous solutions. The propenyl group suggests potential for further chemical reactivity, particularly in addition reactions or polymerization processes. As with many amines, it may exhibit basicity, allowing it to interact with acids and other electrophiles. Its specific applications and biological activity would depend on its structural features and the context of use, making it of interest in fields such as medicinal chemistry or materials science. Safety data and handling precautions should be consulted due to the potential for toxicity associated with amine compounds.

Formula: C₁₇H₁₉NO·ClH

InChI: InChI=1S/C17H19NO.ClH/c1-2-12-18-13-16-10-6-7-11-17(16)19-14-15-8-4-3-5-9-15;/h2-11,18H,1,12-14H2;1H

InChI key: InChIKey=RDZNTGYHKSQABL-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C2=C(CNCC=C)C=CC=C2.Cl

Synonyms:

• Benzenemethanamine, 2-(phenylmethoxy)-N-2-propen-1-yl-, hydrochloride (1:1)

{[2-(benzyloxy)phenyl]methyl}(prop-2-en-1-yl)amine hydrochloride

CAS: 1049678-32-1

Formula: C₁₇H₂₀ClNO

Purity: 95.0%

Molecular weight: 289.8

Ref: 10-F523203