CAS 1049679-56-2

2-Methyl-4-(triethoxysilyl)butanenitrile

Description:

2-Methyl-4-(triethoxysilyl)butanenitrile is a chemical compound characterized by its unique structure, which includes a nitrile functional group and a triethoxysilyl moiety. This compound typically exhibits properties associated with both organic and inorganic chemistry due to the presence of the silicon atom in the triethoxysilyl group. It is likely to be a colorless to pale yellow liquid, with a moderate boiling point and low volatility, making it suitable for various applications in materials science and surface modification. The presence of the nitrile group suggests potential reactivity, particularly in nucleophilic addition reactions. Additionally, the triethoxysilyl group enhances the compound's ability to bond with siliceous surfaces, making it useful as a coupling agent or adhesion promoter in polymer composites and coatings. Its solubility in organic solvents and reactivity with moisture can also be significant for its applications in silane chemistry. Overall, 2-Methyl-4-(triethoxysilyl)butanenitrile is a versatile compound with potential uses in various industrial applications.

Formula: C₁₁H₂₃NO₃Si

InChI: InChI=1S/C11H23NO3Si/c1-5-13-16(14-6-2,15-7-3)9-8-11(4)10-12/h11H,5-9H2,1-4H3

InChI key: InChIKey=ULJQQFHZTZXSMQ-UHFFFAOYSA-N

SMILES: [Si](CCC(C#N)C)(OCC)(OCC)OCC

Synonyms:

• Butanenitrile, 2-methyl-4-(triethoxysilyl)-
• 2-Methyl-4-(triethoxysilyl)butanenitrile
• 3-Cyanobutyl triethoxy silane