CymitQuimica logo

CAS 104970-82-3

:

6-Amino-N,N-diethylhexanamide

Description:
6-Amino-N,N-diethylhexanamide is an organic compound characterized by its amide functional group, which is derived from hexanoic acid. This substance features a six-carbon chain with an amino group (-NH2) and two ethyl groups attached to the nitrogen atom, contributing to its diethyl substitution. The presence of the amino group imparts basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. The compound is likely to be a colorless to pale yellow liquid or solid, depending on its specific form and purity. Its solubility in polar solvents, such as water and alcohols, is expected due to the ability of the amide group to form hydrogen bonds. Additionally, 6-Amino-N,N-diethylhexanamide may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Safety data should be consulted for handling and potential hazards, as with any chemical substance. Overall, this compound's structure and functional groups suggest a range of potential applications in organic synthesis and medicinal chemistry.
Formula:C10H22N2O
InChI:InChI=1S/C10H22N2O/c1-3-12(4-2)10(13)8-6-5-7-9-11/h3-9,11H2,1-2H3
InChI key:InChIKey=AKVAIQVGWQLMBG-UHFFFAOYSA-N
SMILES:N(C(CCCCCN)=O)(CC)CC
Synonyms:
  • Hexanamide, 6-amino-N,N-diethyl-
  • 6-Amino-N,N-diethylhexanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.