
CAS 1049713-25-8
:1-Propanol, 2-methyl-2-[(3-thienylmethyl)amino]-, hydrochloride (1:1)
Description:
1-Propanol, 2-methyl-2-[(3-thienylmethyl)amino]-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a propanol backbone with a methyl group and a thienylmethylamino substituent. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacological properties. The presence of the thienyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as thiophene derivatives are known for their diverse biological activities. The hydrochloride form indicates that it can exist as a stable crystalline solid, making it easier to handle and store. In terms of safety, like many organic compounds, it should be handled with care, as it may pose risks such as irritation or toxicity depending on exposure levels. Overall, this compound's specific characteristics, including its molecular weight, melting point, and solubility, would be essential for applications in research and industry, particularly in drug formulation and development.
Formula:C9H15NOS·ClH
InChI:InChI=1S/C9H15NOS.ClH/c1-9(2,7-11)10-5-8-3-4-12-6-8;/h3-4,6,10-11H,5,7H2,1-2H3;1H
InChI key:InChIKey=CXIOLPDYXIYXDW-UHFFFAOYSA-N
SMILES:C(NC(CO)(C)C)C=1C=CSC1.Cl
Synonyms:- 1-Propanol, 2-methyl-2-[(3-thienylmethyl)amino]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.