CAS 1049713-63-4

Benzenemethanamine, 2-[(2-fluorophenyl)methoxy]-3-methoxy-N-methyl-, hydrochloride (1:1)

Description:

Benzenemethanamine, 2-[(2-fluorophenyl)methoxy]-3-methoxy-N-methyl-, hydrochloride (1:1), with the CAS number 1049713-63-4, is a chemical compound characterized by its complex structure that includes a benzene ring, methoxy groups, and a fluorophenyl moiety. This compound is typically classified as an amine due to the presence of the amine functional group (-NH). The hydrochloride form indicates that it is a salt formed with hydrochloric acid, which often enhances its solubility in water and stability. The presence of fluorine in the structure can influence its biological activity and lipophilicity, potentially affecting its pharmacological properties. Such compounds are often investigated for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The specific arrangement of substituents on the benzene ring can lead to varied interactions with biological targets, making it a subject of interest in drug design and synthesis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₆H₁₈FNO₂·ClH

InChI: InChI=1S/C16H18FNO2.ClH/c1-18-10-12-7-5-9-15(19-2)16(12)20-11-13-6-3-4-8-14(13)17;/h3-9,18H,10-11H2,1-2H3;1H

InChI key: InChIKey=CMNATSIPLYQSSN-UHFFFAOYSA-N

SMILES: O(CC1=C(F)C=CC=C1)C2=C(CNC)C=CC=C2OC.Cl

Synonyms:

• Benzenemethanamine, 2-[(2-fluorophenyl)methoxy]-3-methoxy-N-methyl-, hydrochloride (1:1)

({2-[(2-Fluorophenyl)methoxy]-3-methoxyphenyl}methyl)(methyl)amine hydrochloride

CAS: 1049713-63-4

Versatile small molecule scaffold

Formula: C₁₆H₁₉ClFNO₂

Purity: Min. 95%

Molecular weight: 311.78 g/mol

Ref: 3D-ZRB71363