CAS 1049713-65-6

2-Thiophenemethanamine, N-(3-ethoxypropyl)-5-methyl-, hydrochloride (1:1)

Description:

2-Thiophenemethanamine, N-(3-ethoxypropyl)-5-methyl-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a thiophene ring, an amine group, and an ethoxypropyl substituent. The presence of the thiophene moiety contributes to its potential aromatic properties, while the amine group may impart basic characteristics, allowing it to form salts, such as the hydrochloride form. This compound is likely to exhibit moderate solubility in polar solvents due to the presence of the amine and ethoxy groups, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in areas requiring compounds with specific biological activity. The hydrochloride salt form enhances stability and solubility, making it more suitable for various applications. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.

Formula: C₁₁H₁₉NOS·ClH

InChI: InChI=1S/C11H19NOS.ClH/c1-3-13-8-4-7-12-9-11-6-5-10(2)14-11;/h5-6,12H,3-4,7-9H2,1-2H3;1H

InChI key: InChIKey=FXSMETHAPWTNSK-UHFFFAOYSA-N

SMILES: C(NCCCOCC)C=1SC(C)=CC1.Cl

Synonyms:

• 2-Thiophenemethanamine, N-(3-ethoxypropyl)-5-methyl-, hydrochloride (1:1)