CAS 1049718-73-1

1H-Imidazole, 2-(chloromethyl)-1-(difluoromethyl)-, hydrochloride (1:1)

Description:

1H-Imidazole, 2-(chloromethyl)-1-(difluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a chloromethyl group and a difluoromethyl group contributes to its reactivity and potential applications in medicinal chemistry and organic synthesis. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in biological and chemical processes. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug discovery. Safety and handling precautions should be observed, as halogenated compounds can pose health risks. Overall, this compound represents a unique combination of functional groups that may lead to diverse applications in various fields of chemistry and biochemistry.

Formula: C₅H₅ClF₂N₂·ClH

InChI: InChI=1S/C5H5ClF2N2.ClH/c6-3-4-9-1-2-10(4)5(7)8;/h1-2,5H,3H2;1H

InChI key: InChIKey=GQOFCWFCNXJOBC-UHFFFAOYSA-N

SMILES: C(Cl)C=1N(C(F)F)C=CN1.Cl

Synonyms:

• 1H-Imidazole, 2-(chloromethyl)-1-(difluoromethyl)-, hydrochloride (1:1)
• 2-(Chloromethyl)-1-(difluoromethyl)-1H-imidazole hydrochloride

2-(Chloromethyl)-1-(difluoromethyl)-1h-imidazole hydrochloride

CAS: 1049718-73-1

Purity: 98%

Molecular weight: 203.0099945

Ref: 10-F640086