CymitQuimica logo

CAS 1049727-99-2

:

3-Pyrrolidinecarboxylic acid, 4-(3-methylphenyl)-, hydrochloride (1:1), (3S,4R)-

Description:
3-Pyrrolidinecarboxylic acid, 4-(3-methylphenyl)-, hydrochloride (1:1), (3S,4R)- is a chemical compound characterized by its specific stereochemistry and functional groups. It features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and a carboxylic acid functional group that contributes to its acidity and potential reactivity. The presence of a 3-methylphenyl substituent indicates that there is a methyl group attached to a phenyl ring at the meta position, which can influence the compound's hydrophobicity and interactions with biological systems. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability. The (3S,4R) designation refers to the specific stereochemistry at the chiral centers, which is crucial for its biological activity and pharmacological properties. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies on its pharmacodynamics and pharmacokinetics would be necessary to fully understand its potential uses.
Formula:C12H15NO2
InChI:InChI=1S/C12H15NO2.ClH/c1-8-3-2-4-9(5-8)10-6-13-7-11(10)12(14)15;/h2-5,10-11,13H,6-7H2,1H3,(H,14,15);1H/t10-,11+;/m0./s1
InChI key:InChIKey=POLHJHNHHYTABE-VZXYPILPSA-N
SMILES:C(O)(=O)[C@H]1[C@@H](CNC1)C2=CC(C)=CC=C2.Cl
Synonyms:
  • 3-Pyrrolidinecarboxylic acid, 4-(3-methylphenyl)-, hydrochloride (1:1), (3S,4R)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.