CAS 1049728-25-7

[1,1′-Biphenyl]-3-amine, 4′-methyl-, hydrochloride (1:1)

Description:

[1,1′-Biphenyl]-3-amine, 4′-methyl-, hydrochloride (1:1) is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of an amino group (-NH2) at the 3-position and a methyl group (-CH3) at the 4′-position on one of the phenyl rings contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals and organic synthesis. The compound may exhibit biological activity, potentially acting as a precursor or intermediate in the synthesis of more complex molecules. Its molecular interactions can be influenced by the functional groups present, affecting its reactivity and stability. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken.

Formula: C₁₃H₁₃N·ClH

InChI: InChI=1S/C13H13N.ClH/c1-10-5-7-11(8-6-10)12-3-2-4-13(14)9-12;/h2-9H,14H2,1H3;1H

InChI key: InChIKey=GIHOTHMRRYLUGK-UHFFFAOYSA-N

SMILES: NC=1C=C(C=CC1)C2=CC=C(C)C=C2.Cl

Synonyms:

• [1,1′-Biphenyl]-3-amine, 4′-methyl-, hydrochloride (1:1)

4'-Methyl-[1,1'-biphenyl]-3-amine hydrochloride

CAS: 1049728-25-7

Versatile small molecule scaffold

Formula: C₁₃H₁₄ClN

Purity: Min. 95%

Molecular weight: 219.71 g/mol

Ref: 3D-ZRB72825