CymitQuimica logo

CAS 1049729-87-4

:

3-(1-Azetidinyl)-6-bromopyridazine

Description:
3-(1-Azetidinyl)-6-bromopyridazine is a chemical compound characterized by its unique structure, which includes a pyridazine ring substituted with a bromine atom and an azetidine moiety. The presence of the azetidine ring contributes to its potential biological activity, as this five-membered nitrogen-containing heterocycle is often found in various pharmaceuticals. The bromine substitution on the pyridazine ring can influence the compound's reactivity and solubility, making it of interest in medicinal chemistry. This compound may exhibit specific pharmacological properties, potentially acting as a ligand or inhibitor in biological systems. Its molecular interactions can be studied through various techniques, including spectroscopy and crystallography, to elucidate its behavior in different environments. Additionally, the compound's synthesis and stability are important considerations for its application in research and development. Overall, 3-(1-Azetidinyl)-6-bromopyridazine represents a class of compounds that may have significant implications in drug discovery and development.
Formula:C7H8BrN3
InChI:InChI=1S/C7H8BrN3/c8-6-2-3-7(10-9-6)11-4-1-5-11/h2-3H,1,4-5H2
InChI key:InChIKey=GXIIFMJIXJVYKU-UHFFFAOYSA-N
SMILES:BrC1=CC=C(N2CCC2)N=N1
Synonyms:
  • 3-(1-Azetidinyl)-6-bromopyridazine
  • Pyridazine, 3-(1-azetidinyl)-6-bromo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.