
CAS 1049730-38-2
:4-Pyridinamine, 2,6-dichloro-, hydrochloride (1:1)
Description:
4-Pyridinamine, 2,6-dichloro-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure substituted with amino and chloro groups. The presence of the amino group (-NH2) indicates its potential as a base, while the dichloro substitutions at the 2 and 6 positions of the pyridine ring enhance its reactivity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in various applications, including pharmaceuticals and agrochemicals. The compound may exhibit properties such as antimicrobial or anti-inflammatory activities, making it of interest in medicinal chemistry. Its molecular structure contributes to its potential interactions with biological targets, and its stability can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C5H4Cl2N2·ClH
InChI:InChI=1S/C5H4Cl2N2.ClH/c6-4-1-3(8)2-5(7)9-4;/h1-2H,(H2,8,9);1H
InChI key:InChIKey=SATKHNGZXGJMEW-UHFFFAOYSA-N
SMILES:NC=1C=C(Cl)N=C(Cl)C1.Cl
Synonyms:- 4-Pyridinamine, 2,6-dichloro-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.