CymitQuimica logo

CAS 1049734-07-7

:

(3R,4S)-4-(Naphthalen-1-Yl)Pyrrolidine-3-Carboxylic Acid Hydrochloride

Description:
(3R,4S)-4-(Naphthalen-1-Yl)Pyrrolidine-3-Carboxylic Acid Hydrochloride is a chemical compound characterized by its specific stereochemistry, indicated by the (3R,4S) configuration, which refers to the arrangement of substituents around the chiral centers in the pyrrolidine ring. This compound features a naphthyl group, which contributes to its aromatic properties and potential interactions in biological systems. As a carboxylic acid derivative, it possesses acidic characteristics, allowing it to participate in various chemical reactions, including esterification and amidation. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which often enhances its solubility in water and stability. This compound may be of interest in pharmaceutical research due to its structural features, which could influence its biological activity and interactions with biological targets. Its specific applications and effects would depend on ongoing research and development in medicinal chemistry.
Formula:C15H16ClNO2
InChI:InChI=1S/C15H15NO2.ClH/c17-15(18)14-9-16-8-13(14)12-7-3-5-10-4-1-2-6-11(10)12;/h1-7,13-14,16H,8-9H2,(H,17,18);1H/t13-,14+;/m0./s1
InChI key:PHHZADOJTQLSMJ-LMRHVHIWSA-N
SMILES:C1[C@H]([C@@H](CN1)C(=O)O)C2=CC=CC3=CC=CC=C32.Cl
Found 2 products.