CAS 1049743-00-1

Ethanamine, N-[2-(4-chlorophenoxy)ethyl]-2-methoxy-, hydrochloride (1:1)

Description:

Ethanamine, N-[2-(4-chlorophenoxy)ethyl]-2-methoxy-, hydrochloride (1:1), commonly referred to as a hydrochloride salt, is a chemical compound characterized by its amine functional group and ether linkage. This substance features a 4-chlorophenoxy group, which contributes to its potential biological activity, and a methoxy group that may influence its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The presence of the chlorine atom on the phenyl ring can enhance the compound's lipophilicity, potentially affecting its pharmacokinetics. Additionally, the ethyl chain connecting the amine and phenoxy groups may play a role in the compound's overall conformation and interaction with biological targets. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₁H₁₆ClNO₂·ClH

InChI: InChI=1S/C11H16ClNO2.ClH/c1-14-8-6-13-7-9-15-11-4-2-10(12)3-5-11;/h2-5,13H,6-9H2,1H3;1H

InChI key: InChIKey=AOUWUSIBISJGPY-UHFFFAOYSA-N

SMILES: O(CCNCCOC)C1=CC=C(Cl)C=C1.Cl

Synonyms:

• Ethanamine, N-[2-(4-chlorophenoxy)ethyl]-2-methoxy-, hydrochloride (1:1)