CAS 1049744-24-2

[1,1′-Biphenyl]-3-carbonitrile, 3′-amino-, hydrochloride (1:1)

Description:

[1,1′-Biphenyl]-3-carbonitrile, 3′-amino-, hydrochloride (1:1) is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carbonitrile group (-C≡N) at the 3-position and an amino group (-NH2) at the 3′-position contributes to its reactivity and potential applications in organic synthesis and pharmaceuticals. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which often enhances its solubility in water and stability. This compound may exhibit properties such as being a potential intermediate in the synthesis of various organic compounds or pharmaceuticals. Its specific interactions, such as hydrogen bonding due to the amino group, can influence its biological activity and solubility. As with many organic compounds, safety precautions should be taken when handling it, including the use of appropriate personal protective equipment, as it may pose health risks if ingested or inhaled.

Formula: C₁₃H₁₀N₂·ClH

InChI: InChI=1S/C13H10N2.ClH/c14-9-10-3-1-4-11(7-10)12-5-2-6-13(15)8-12;/h1-8H,15H2;1H

InChI key: InChIKey=NYOUTQMBXQFWJN-UHFFFAOYSA-N

SMILES: C(#N)C=1C=C(C=CC1)C2=CC(N)=CC=C2.Cl

Synonyms:

• [1,1′-Biphenyl]-3-carbonitrile, 3′-amino-, hydrochloride (1:1)

3′-Amino-biphenyl-3-carbonitrilehydrochloride

CAS: 1049744-24-2

Formula: C₁₃H₁₁ClN₂

Color and Shape: Solid

Molecular weight: 230.7

Ref: 10-F020769