CymitQuimica logo

CAS 1049745-41-6

:

<span class="text-smallcaps">L</span>-Proline, 4-(4-thiazolylmethyl)-, hydrochloride (1:1), (4S)-

Description:
L-Proline, 4-(4-thiazolylmethyl)-, hydrochloride (1:1), (4S)- is a chemical compound characterized by its unique structure that includes a proline amino acid backbone modified with a thiazole ring. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in aqueous solutions, making it useful in various biochemical applications. The presence of the thiazole moiety contributes to its potential biological activity, possibly influencing interactions with proteins or enzymes. As a chiral molecule, it exhibits specific stereochemistry, which can be crucial for its biological function and activity. The compound may be utilized in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Its CAS number, 1049745-41-6, allows for precise identification and cataloging in chemical databases. Overall, this compound exemplifies the intersection of organic chemistry and medicinal applications, highlighting the importance of structural modifications in enhancing the properties of amino acids for therapeutic use.
Formula:C9H12N2O2S.ClH
InChI:InChI=1S/C9H12N2O2S.ClH/c12-9(13)8-2-6(3-10-8)1-7-4-14-5-11-7;/h4-6,8,10H,1-3H2,(H,12,13);1H/t6-,8+;/m1./s1
InChI key:InChIKey=BFWVVLPPUAXRAI-HNJRQZNRSA-N
SMILES:C([C@@H]1C[C@@H](C(O)=O)NC1)C2=CSC=N2.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.