CymitQuimica logo

CAS 1049745-43-8

:

Thiazole, 4-(chloromethyl)-2-(3-thienyl)-, hydrochloride (1:1)

Description:
Thiazole, 4-(chloromethyl)-2-(3-thienyl)-, hydrochloride (1:1) is a chemical compound characterized by its thiazole and thienyl moieties, which contribute to its unique properties. The thiazole ring is a five-membered heterocyclic structure containing both sulfur and nitrogen, while the thienyl group is derived from thiophene, featuring a sulfur atom in its ring. The presence of a chloromethyl group enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in biological and pharmaceutical applications. The compound may exhibit biological activity, potentially serving as a lead compound in drug discovery. However, specific biological effects, toxicity, and pharmacokinetics would require further investigation through empirical studies. Overall, this compound's structural features suggest it could be of interest in medicinal chemistry and materials science.
Formula:C8H6ClNS2·ClH
InChI:InChI=1S/C8H6ClNS2.ClH/c9-3-7-5-12-8(10-7)6-1-2-11-4-6;/h1-2,4-5H,3H2;1H
InChI key:InChIKey=NLGYQFYRSIDLIM-UHFFFAOYSA-N
SMILES:C(Cl)C=1N=C(SC1)C=2C=CSC2.Cl
Synonyms:
  • Thiazole, 4-(chloromethyl)-2-(3-thienyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.