CAS 1049756-51-5

Acetamide, 2-chloro-N-[3-(methylphenylamino)propyl]-, hydrochloride (1:1)

Description:

Acetamide, 2-chloro-N-[3-(methylphenylamino)propyl]-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential applications in pharmaceuticals and organic synthesis. The presence of a chloro substituent suggests that it may exhibit unique reactivity patterns, making it useful in various chemical reactions. The compound features a propyl chain linked to a methylphenylamino group, which can influence its biological activity and solubility properties. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in biological and chemical applications. The molecular structure implies potential interactions with biological targets, which may be of interest in drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated groups, due to potential toxicity and environmental impact. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₁₂H₁₇ClN₂O·ClH

InChI: InChI=1S/C12H17ClN2O.ClH/c1-15(11-6-3-2-4-7-11)9-5-8-14-12(16)10-13;/h2-4,6-7H,5,8-10H2,1H3,(H,14,16);1H

InChI key: InChIKey=WLYCKEYXWMYXTF-UHFFFAOYSA-N

SMILES: N(CCCNC(CCl)=O)(C)C1=CC=CC=C1.Cl

Synonyms:

• Acetamide, 2-chloro-N-[3-(methylphenylamino)propyl]-, hydrochloride (1:1)