CAS 1049773-86-5

Benzenemethanamine, 4-(methylthio)-N-propyl-, hydrochloride (1:1)

Description:

Benzenemethanamine, 4-(methylthio)-N-propyl-, hydrochloride (1:1), commonly referred to as a substituted phenethylamine, is a chemical compound characterized by its amine functional group and a methylthio substituent on the benzene ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of the propyl group contributes to its hydrophobic characteristics, influencing its interaction with biological systems. As a member of the phenethylamine class, it may exhibit psychoactive properties, although specific pharmacological effects would depend on its structure and the presence of other functional groups. Its applications may range from research in medicinal chemistry to potential uses in pharmaceuticals, although safety and regulatory considerations are paramount. Proper handling and storage conditions are essential due to its classification and potential biological activity.

Formula: C₁₁H₁₇NS·ClH

InChI: InChI=1S/C11H17NS.ClH/c1-3-8-12-9-10-4-6-11(13-2)7-5-10;/h4-7,12H,3,8-9H2,1-2H3;1H

InChI key: InChIKey=GXUDXDUTRWFAFM-UHFFFAOYSA-N

SMILES: C(NCCC)C1=CC=C(SC)C=C1.Cl

Synonyms:

• Benzenemethanamine, 4-(methylthio)-N-propyl-, hydrochloride (1:1)