
CAS 1049872-60-7
:N-[4-[(2-Chloroacetyl)amino]phenyl]-4-morpholineacetamide
Description:
N-[4-[(2-Chloroacetyl)amino]phenyl]-4-morpholineacetamide is a synthetic organic compound characterized by its complex structure, which includes a morpholine ring, an acetamide group, and a chloroacetyl moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential reactivity due to the presence of the chloroacetyl group, which can participate in nucleophilic substitution reactions. The morpholine ring contributes to its overall stability and may influence its biological activity. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, the presence of chlorine in the structure may enhance lipophilicity, affecting its pharmacokinetic properties. Overall, N-[4-[(2-Chloroacetyl)amino]phenyl]-4-morpholineacetamide represents a class of compounds that may exhibit interesting biological activities, warranting further investigation in drug discovery and development contexts.
Formula:C14H18ClN3O3
InChI:InChI=1S/C14H18ClN3O3/c15-9-13(19)16-11-1-3-12(4-2-11)17-14(20)10-18-5-7-21-8-6-18/h1-4H,5-10H2,(H,16,19)(H,17,20)
InChI key:InChIKey=ABLSOKONMLXVMJ-UHFFFAOYSA-N
SMILES:N(C(CN1CCOCC1)=O)C2=CC=C(NC(CCl)=O)C=C2
Synonyms:- N-[4-[(2-Chloroacetyl)amino]phenyl]-4-morpholineacetamide
- 2-Chloro-N-[4-[2-(morpholin-4-yl)acetamido]phenyl]acetamide
- 4-Morpholineacetamide, N-[4-[(2-chloroacetyl)amino]phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.