CymitQuimica logo

CAS 1049873-04-2

:

Ethanone, 2-(3,4-dimethylphenyl)-1-phenyl-

Description:
Ethanone, 2-(3,4-dimethylphenyl)-1-phenyl-, also known by its CAS number 1049873-04-2, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a central ethanone moiety with two phenyl groups and a 3,4-dimethyl-substituted phenyl group attached, contributing to its unique chemical properties. The presence of multiple aromatic rings typically imparts stability and influences its reactivity, making it potentially useful in various chemical applications, including organic synthesis and materials science. The compound is likely to exhibit hydrophobic characteristics due to its extensive aromatic structure, which may affect its solubility in polar solvents. Additionally, the presence of methyl groups can influence its electronic properties and steric hindrance, impacting its interactions with other molecules. As with many organic compounds, safety and handling precautions should be observed, particularly regarding potential toxicity and environmental impact. Further studies would be necessary to fully elucidate its physical properties, reactivity, and potential applications in various fields.
Formula:C16H16O
InChI:InChI=1S/C16H16O/c1-12-8-9-14(10-13(12)2)11-16(17)15-6-4-3-5-7-15/h3-10H,11H2,1-2H3
InChI key:InChIKey=KYCIVJYCYUSESU-UHFFFAOYSA-N
SMILES:C(C(=O)C1=CC=CC=C1)C2=CC(C)=C(C)C=C2
Synonyms:
  • 2-(3,4-Dimethylphenyl)-1-phenylethanone
  • Ethanone, 2-(3,4-dimethylphenyl)-1-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.