CAS 1049873-22-4

1-[4-(Cyclopentylsulfonyl)phenyl]ethanone

Description:

1-[4-(Cyclopentylsulfonyl)phenyl]ethanone, identified by its CAS number 1049873-22-4, is an organic compound characterized by its unique molecular structure, which includes a phenyl ring substituted with a cyclopentylsulfonyl group and an ethanone moiety. This compound typically exhibits properties associated with sulfonyl-containing aromatic compounds, such as moderate to high polarity due to the sulfonyl functional group. It may also display significant solubility in organic solvents, making it useful in various chemical applications. The presence of the cyclopentyl group can influence its steric and electronic properties, potentially affecting its reactivity and interactions in chemical reactions. Additionally, compounds of this nature may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. However, specific physical properties such as melting point, boiling point, and spectral data would need to be referenced from experimental sources or databases for precise characterization.

Formula: C₁₃H₁₆O₃S

InChI: InChI=1S/C13H16O3S/c1-10(14)11-6-8-13(9-7-11)17(15,16)12-4-2-3-5-12/h6-9,12H,2-5H2,1H3

InChI key: InChIKey=PDRBLTYVTKBWDL-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC=C(C(C)=O)C=C1)C2CCCC2

Synonyms:

• Ethanone, 1-[4-(cyclopentylsulfonyl)phenyl]-
• 1-[4-(Cyclopentylsulfonyl)phenyl]ethanone