CymitQuimica logo

CAS 1049873-38-2

:

1,2-Dihydro-6-(1-methylethyl)-2-oxopyrazolo[1,5-a]pyrimidine-7-carboxylic acid

Description:
1,2-Dihydro-6-(1-methylethyl)-2-oxopyrazolo[1,5-a]pyrimidine-7-carboxylic acid is a heterocyclic compound characterized by its complex pyrazolo-pyrimidine structure. This compound features a dihydro-pyrazole ring fused to a pyrimidine moiety, which contributes to its unique chemical properties. The presence of a carboxylic acid functional group enhances its acidity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions and applications. The isopropyl group (1-methylethyl) attached to the pyrazolo ring influences its steric and electronic properties, potentially affecting its reactivity and solubility. This compound may exhibit biological activity, which is common among similar heterocycles, and could be of interest in medicinal chemistry. Its specific interactions and applications would depend on further studies, including its synthesis, stability, and potential pharmacological effects. As with many heterocycles, the compound's properties can be influenced by environmental factors such as pH and solvent polarity.
Formula:C10H11N3O3
InChI:InChI=1S/C10H11N3O3/c1-5(2)6-4-11-7-3-8(14)12-13(7)9(6)10(15)16/h3-5H,1-2H3,(H,12,14)(H,15,16)
InChI key:InChIKey=QIBUOSGDGUHTOB-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N2C(N=CC1C(C)C)=CC(=O)N2
Synonyms:
  • 1,2-Dihydro-6-(1-methylethyl)-2-oxopyrazolo[1,5-a]pyrimidine-7-carboxylic acid
  • Pyrazolo[1,5-a]pyrimidine-7-carboxylic acid, 1,2-dihydro-6-(1-methylethyl)-2-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.