CAS 1049873-48-4
:4-Methoxy-N,N,3,5-tetramethyl-2-pyridinemethanamine
Description:
4-Methoxy-N,N,3,5-tetramethyl-2-pyridinemethanamine, identified by its CAS number 1049873-48-4, is a chemical compound that belongs to the class of pyridine derivatives. This substance features a pyridine ring substituted with a methoxy group and multiple methyl groups, contributing to its unique structural and electronic properties. The presence of the methoxy group enhances its solubility in organic solvents, while the tetramethyl substitutions can influence its steric hindrance and reactivity. Typically, compounds of this nature may exhibit biological activity, potentially serving as intermediates in organic synthesis or as ligands in coordination chemistry. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which can affect its physical properties such as melting point, boiling point, and solubility. Additionally, due to its nitrogen-containing structure, it may exhibit basicity, allowing it to interact with acids to form salts. Overall, 4-Methoxy-N,N,3,5-tetramethyl-2-pyridinemethanamine is a versatile compound with potential applications in various fields of chemistry and biochemistry.
Formula:C11H18N2O
InChI:InChI=1S/C11H18N2O/c1-8-6-12-10(7-13(3)4)9(2)11(8)14-5/h6H,7H2,1-5H3
InChI key:InChIKey=YWLJNUAYBRWEJY-UHFFFAOYSA-N
SMILES:C(N(C)C)C1=C(C)C(OC)=C(C)C=N1
Synonyms:- 2-Pyridinemethanamine, 4-methoxy-N,N,3,5-tetramethyl-
- 4-Methoxy-N,N,3,5-tetramethyl-2-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.