CymitQuimica logo

CAS 1049873-95-1

:

N-Butyl-5-(chloromethyl)-1,2,4-oxadiazole-3-acetamide

Description:
N-Butyl-5-(chloromethyl)-1,2,4-oxadiazole-3-acetamide is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a butyl group, which contributes to its hydrophobic characteristics, and a chloromethyl group that enhances its reactivity, making it a potential intermediate in organic synthesis. The acetamide functional group indicates the presence of an amide bond, which can influence the compound's solubility and biological activity. Typically, compounds of this nature may exhibit various biological properties, including antimicrobial or antifungal activities, due to the presence of the oxadiazole moiety. The specific properties, such as melting point, solubility, and reactivity, would depend on the molecular structure and the presence of substituents. As with many synthetic compounds, safety and handling precautions are essential, given the potential toxicity associated with chlorinated compounds. Further studies would be necessary to fully elucidate its applications and biological effects.
Formula:C9H14ClN3O2
InChI:InChI=1S/C9H14ClN3O2/c1-2-3-4-11-8(14)5-7-12-9(6-10)15-13-7/h2-6H2,1H3,(H,11,14)
InChI key:InChIKey=XDWRQMKAQFPZFJ-UHFFFAOYSA-N
SMILES:C(C(NCCCC)=O)C=1N=C(CCl)ON1
Synonyms:
  • N-Butyl-5-(chloromethyl)-1,2,4-oxadiazole-3-acetamide
  • 1,2,4-Oxadiazole-3-acetamide, N-butyl-5-(chloromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.