CAS 1049874-00-1

3-Methylisoxazolo[5,4-b]pyridine-5-carboxaldehyde oxime

Description:

3-Methylisoxazolo[5,4-b]pyridine-5-carboxaldehyde oxime is a heterocyclic organic compound characterized by its unique structural features, which include a fused isoxazole and pyridine ring system. This compound contains a carboxaldehyde functional group and an oxime, which is formed by the reaction of the aldehyde with hydroxylamine. The presence of the methyl group at the 3-position of the isoxazole ring contributes to its chemical reactivity and potential biological activity. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The oxime functional group can participate in various chemical reactions, including condensation and rearrangement, which may be useful in synthetic applications. Additionally, the compound's solubility and stability can be influenced by the presence of the heteroatoms and functional groups, affecting its behavior in different solvents and under varying conditions. Overall, 3-Methylisoxazolo[5,4-b]pyridine-5-carboxaldehyde oxime represents a class of compounds with potential utility in research and development within the fields of organic and medicinal chemistry.

Formula: C₈H₇N₃O₂

InChI: InChI=1S/C8H7N3O2/c1-5-7-2-6(4-10-12)3-9-8(7)13-11-5/h2-4,12H,1H3

InChI key: InChIKey=PCLLMIDSQFJYSA-UHFFFAOYSA-N

SMILES: CC=1C=2C(=NC=C(C=NO)C2)ON1

Synonyms:

• Isoxazolo[5,4-b]pyridine-5-carboxaldehyde, 3-methyl-, oxime
• 3-Methylisoxazolo[5,4-b]pyridine-5-carboxaldehyde oxime

N-({3-Methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl}methylidene)hydroxylamine

CAS: 1049874-00-1

Versatile small molecule scaffold

Formula: C₈H₇N₃O₂

Purity: Min. 95%

Molecular weight: 177.16 g/mol

Ref: 3D-ZRB87400