CAS 1049874-33-0: N-[(3-Aminophenyl)methyl]-N-methylacetamide

Description:N-[(3-Aminophenyl)methyl]-N-methylacetamide, identified by its CAS number 1049874-33-0, is an organic compound characterized by its amide functional group. This substance features a methyl group and an acetamide moiety attached to a 3-aminophenyl group, which contributes to its potential biological activity. The presence of the amino group suggests that it may engage in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds of this nature may exhibit moderate polarity, making them soluble in polar solvents while retaining some hydrophobic characteristics due to the aromatic ring. The molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the amine and acetamide functionalities can interact with biological targets. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are critical in determining its behavior in various chemical environments. Overall, N-[(3-Aminophenyl)methyl]-N-methylacetamide represents a class of compounds with significant interest in both synthetic and applied chemistry.

Formula:C₁₀H₁₄N₂O

InChI:InChI=1S/C10H14N2O/c1-8(13)12(2)7-9-4-3-5-10(11)6-9/h3-6H,7,11H2,1-2H3

InChI key:InChIKey=NQUCVLGXDOVVIV-UHFFFAOYSA-N

SMILES:O=C(N(C)CC=1C=CC=C(N)C1)C