CymitQuimica logo

CAS 1049874-41-0

:

2-(1,1-Dimethylethyl) 3,4,5,6-tetrahydrocyclopenta[c]pyrrole-2,5(1H)-dicarboxylate

Description:
2-(1,1-Dimethylethyl) 3,4,5,6-tetrahydrocyclopenta[c]pyrrole-2,5(1H)-dicarboxylate is a chemical compound characterized by its complex bicyclic structure, which includes a pyrrole ring fused to a cyclopentane moiety. This compound features two carboxylate functional groups, contributing to its potential reactivity and solubility properties. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric bulk, which can influence its interactions with other molecules and its overall stability. The dicarboxylate structure suggests that it may participate in various chemical reactions, including esterification and amidation. Additionally, the compound may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Its specific physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a unique structure with potential applications in organic synthesis and pharmaceuticals.
Formula:C13H19NO4
InChI:InChI=1S/C13H19NO4/c1-13(2,3)18-12(17)14-6-9-4-8(11(15)16)5-10(9)7-14/h8H,4-7H2,1-3H3,(H,15,16)
InChI key:InChIKey=LNPSYPDAAAHAAD-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC2=C(CC(C(O)=O)C2)C1
Synonyms:
  • Cyclopenta[c]pyrrole-2,5(1H)-dicarboxylic acid, 3,4,5,6-tetrahydro-, 2-(1,1-dimethylethyl) ester
  • 2-(1,1-Dimethylethyl) 3,4,5,6-tetrahydrocyclopenta[c]pyrrole-2,5(1H)-dicarboxylate
  • 2-[(tert-Butoxy)carbonyl]-1H,2H,3H,4H,5H,6H-cyclopenta[c]pyrrole-5-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.